cas: 97760-76-4 — see every product listed under this CAS number, including other names
1-(4-Amino-3-chloro-5-(trifluoromethyl)phenyl)ethanone, 97%, 97% (CAS 97760-76-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJZA-50mg |
| cas | 97760-76-4 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 107.60 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 813.20 Pln | |
| Chemat | 10g | 1494.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone (CAS 97760-76-4) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone. InChIKey: GVPVKKWXJXESIC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | GVPVKKWXJXESIC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Cl)N)C(F)(F)F |
Computed by PubChem (NCBI)