CAS 64694-83-3 appears in our catalog under these names: N–(3–Chloro–4–methylphenyl)–2,2,2–trifluoroacetamide, N-(3-Chloro-4-methylphenyl)-2,2,2-trifluoroacetamide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
N-(3-chloro-4-methylphenyl)-2,2,2-trifluoroacetamide (CAS 64694-83-3) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: N-(3-chloro-4-methylphenyl)-2,2,2-trifluoroacetamide. InChIKey: QAYBTXGTTUWWHN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | N-(3-chloro-4-methylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | QAYBTXGTTUWWHN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)