Products 731011-90-8
CAS 731011-90-8 is the registry number for 2-Chloro-n-(2,3,4-trifluorophenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2,3,4-trifluorophenyl)propanamide (CAS 731011-90-8) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: 2-chloro-N-(2,3,4-trifluorophenyl)propanamide. InChIKey: ZDXFSIFUFRWIQZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | 2-chloro-N-(2,3,4-trifluorophenyl)propanamide |
| InChIKey | ZDXFSIFUFRWIQZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C(=C(C=C1)F)F)F)Cl |
Computed by PubChem (NCBI)