cas: 68104-62-1 — see every product listed under this CAS number, including other names
1-(4-BROMOPHENYL)PIPERAZINE HYDROCHLORIDE, 97%, 97% (CAS 68104-62-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAMG-1g |
| cas | 68104-62-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 875.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)piperazine;hydrochloride (CAS 68104-62-1) is a chemical compound with the molecular formula C10H14BrClN2 and a molecular weight of 277.59 g/mol. IUPAC name: 1-(4-bromophenyl)piperazine;hydrochloride. InChIKey: YDVSFRZKQMQPJD-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2 |
|---|---|
| Molecular weight | 277.59 g/mol |
| IUPAC name | 1-(4-bromophenyl)piperazine;hydrochloride |
| InChIKey | YDVSFRZKQMQPJD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)