cas: 1414870-53-3 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-chlorophenyl)-N,N-dimethylmethanamine 97% (CAS 1414870-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A968078-100mg |
| cas | 1414870-53-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1082.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A968078 |
1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine (CAS 1414870-53-3) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine. InChIKey: MBZYFQGJMCBYTQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine |
| InChIKey | MBZYFQGJMCBYTQ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)