cas: 1414870-53-3 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-chlorophenyl)-N,N-dimethylmethanamine, 97%, 97% (CAS 1414870-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K0SN-100mg |
| cas | 1414870-53-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 875.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine (CAS 1414870-53-3) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine. InChIKey: MBZYFQGJMCBYTQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)-N,N-dimethylmethanamine |
| InChIKey | MBZYFQGJMCBYTQ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)