CAS 1197595-75-7 appears in our catalog under these names: 5-Bromo-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 5-bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride 97%, 5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, 5-BROMO-2,3-DIHYDRO-1H-INDEN-1-AMINE-HCL, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 2,5g.
5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1197595-75-7) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: GLGQSSHHFWJLAI-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | GLGQSSHHFWJLAI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)