cas: 1159826-63-7 — see every product listed under this CAS number, including other names
1-(4-Bromobenzyl)-1H-pyrazole 95% (CAS 1159826-63-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750153-10g |
| cas | 1159826-63-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 4175.12 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2634.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750153 |
1-[(4-bromophenyl)methyl]pyrazole (CAS 1159826-63-7) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]pyrazole. InChIKey: JWKUEIBUDOSNAH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]pyrazole |
| InChIKey | JWKUEIBUDOSNAH-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)