cas: 1159826-63-7 — see every product listed under this CAS number, including other names
1-(4-Bromobenzyl)-1H-pyrazole, 95%, 95% (CAS 1159826-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HCL-100mg |
| cas | 1159826-63-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1984.40 Pln | |
| Chemat | 10g | 3136.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(4-bromophenyl)methyl]pyrazole (CAS 1159826-63-7) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]pyrazole. InChIKey: JWKUEIBUDOSNAH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]pyrazole |
| InChIKey | JWKUEIBUDOSNAH-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)