cas: 7295-46-7 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)hexan-1-one 98% (CAS 7295-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A966673-250mg |
| cas | 7295-46-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Ambeed | 10g | 1076.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A966673 |
1-(4-bromophenyl)hexan-1-one (CAS 7295-46-7) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromophenyl)hexan-1-one. InChIKey: MVLMRPWLTMFPJI-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromophenyl)hexan-1-one |
| InChIKey | MVLMRPWLTMFPJI-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)