cas: 36871-55-3 — see every product listed under this CAS number, including other names
1-(4-Chloro-2-methoxyphenyl)propan-1-one 95% (CAS 36871-55-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A291584-10g |
| cas | 36871-55-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1577.44 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 987.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A291584 |
1-(4-chloro-2-methoxyphenyl)propan-1-one (CAS 36871-55-3) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 1-(4-chloro-2-methoxyphenyl)propan-1-one. InChIKey: PELVKTMDDXVZAT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 1-(4-chloro-2-methoxyphenyl)propan-1-one |
| InChIKey | PELVKTMDDXVZAT-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Cl)OC |
Computed by PubChem (NCBI)