cas: 63874-99-7 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-1H-pyrazole-4-carbaldehyde 97% (CAS 63874-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A507606-100mg |
| cas | 63874-99-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A507606 |
1-(4-chlorophenyl)pyrazole-4-carbaldehyde (CAS 63874-99-7) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrazole-4-carbaldehyde. InChIKey: VZQVRKCGPMBZQL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrazole-4-carbaldehyde |
| InChIKey | VZQVRKCGPMBZQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)C=O)Cl |
Computed by PubChem (NCBI)