cas: 1431470-48-2 — see every product listed under this CAS number, including other names
1-(4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-N,N-dimethylmethanamine, 95% (CAS 1431470-48-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A840579-10g |
| cas | 1431470-48-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13610.80 Pln | |
| AmBeed | 5g | 8194.48 Pln | |
| AmBeed | 25g | 23766.40 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine (CAS 1431470-48-2) is a chemical compound with the molecular formula C15H23BFNO2 and a molecular weight of 279.16 g/mol. IUPAC name: 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine. InChIKey: WMMHWBVAEMEASZ-UHFFFAOYSA-N.
| Molecular formula | C15H23BFNO2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine |
| InChIKey | WMMHWBVAEMEASZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CN(C)C)F |
Computed by PubChem (NCBI)