CAS 2223035-43-4 is the registry number for 2-(tert-Butyl)-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223035-43-4) is a chemical compound with the molecular formula C15H23BFNO2 and a molecular weight of 279.16 g/mol. IUPAC name: 2-tert-butyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: AYGYXJNEEUSLAH-UHFFFAOYSA-N.
| Molecular formula | C15H23BFNO2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 2-tert-butyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | AYGYXJNEEUSLAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2F)C(C)(C)C |
Computed by PubChem (NCBI)