cas: 157187-14-9 — see every product listed under this CAS number, including other names
1-(4-Fluorophenylsulfonyl)pyrrolidine, ≥98%, ≥98% (CAS 157187-14-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AAZ0-250mg |
| cas | 157187-14-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-(4-fluorophenyl)sulfonylpyrrolidine (CAS 157187-14-9) is a chemical compound with the molecular formula C10H12FNO2S and a molecular weight of 229.27 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylpyrrolidine. InChIKey: BLFZDHIRHPQTDJ-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2S |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylpyrrolidine |
| InChIKey | BLFZDHIRHPQTDJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)