CAS 157187-14-9 appears in our catalog under these names: 1-(4-Fluorophenylsulfonyl)pyrrolidine, 98%, 1-(4-Fluorophenylsulfonyl)pyrrolidine, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
1-(4-fluorophenyl)sulfonylpyrrolidine (CAS 157187-14-9) is a chemical compound with the molecular formula C10H12FNO2S and a molecular weight of 229.27 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylpyrrolidine. InChIKey: BLFZDHIRHPQTDJ-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2S |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylpyrrolidine |
| InChIKey | BLFZDHIRHPQTDJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)