Products 1537863-72-1
CAS 1537863-72-1 is the registry number for 6-(4-Fluorophenyl)-1,2-thiazinane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4-fluorophenyl)thiazinane 1,1-dioxide (CAS 1537863-72-1) is a chemical compound with the molecular formula C10H12FNO2S and a molecular weight of 229.27 g/mol. IUPAC name: 6-(4-fluorophenyl)thiazinane 1,1-dioxide. InChIKey: ATUDDESTXJDZHG-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2S |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 6-(4-fluorophenyl)thiazinane 1,1-dioxide |
| InChIKey | ATUDDESTXJDZHG-UHFFFAOYSA-N |
| SMILES | C1CC(S(=O)(=O)NC1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)