cas: 7306-39-0 — see every product listed under this CAS number, including other names
1-(4-Isopropylphenyl)propan-2-one 95% (CAS 7306-39-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A374552-100mg |
| cas | 7306-39-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A374552 |
1-(4-propan-2-ylphenyl)propan-2-one (CAS 7306-39-0) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-(4-propan-2-ylphenyl)propan-2-one. InChIKey: APWPLZAFFOTPRO-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-(4-propan-2-ylphenyl)propan-2-one |
| InChIKey | APWPLZAFFOTPRO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CC(=O)C |
Computed by PubChem (NCBI)