CAS 7306-39-0 appears in our catalog under these names: 4'-Isopropylphenylacetone, 95%, 4'-Isopropylphenylacetone, 1-(4-Isopropylphenyl)propan-2-one 95%, 1-(4-Isopropylphenyl)propan-2-one, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 0,5g, 2g, 100mg, 250mg.
1-(4-propan-2-ylphenyl)propan-2-one (CAS 7306-39-0) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-(4-propan-2-ylphenyl)propan-2-one. InChIKey: APWPLZAFFOTPRO-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-(4-propan-2-ylphenyl)propan-2-one |
| InChIKey | APWPLZAFFOTPRO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CC(=O)C |
Computed by PubChem (NCBI)