cas: 50921-38-5 — see every product listed under this CAS number, including other names
1-(4-METHYLPHENYL)CYCLOBUTANE-1-CARBOXYLIC ACID, 97% (CAS 50921-38-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305003-50MG |
| cas | 50921-38-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 289.50 Pln | |
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 500mg | 997.58 Pln | |
| Fluorochem | 1g | 1637.98 Pln | |
| Fluorochem | 2.5g | 3621.66 Pln | |
| Fluorochem | 5g | 5417.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-methylphenyl)cyclobutane-1-carboxylic acid (CAS 50921-38-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 1-(4-methylphenyl)cyclobutane-1-carboxylic acid. InChIKey: GFNPCJCIUWSWIV-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-(4-methylphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | GFNPCJCIUWSWIV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)