CAS 50921-38-5 appears in our catalog under these names: 1-(4-Methylphenyl)cyclobutane-1-carboxylic acid, 95%, 1-(4-Methylphenyl)cyclobutanecarboxylic acid, 1-(4-METHYLPHENYL)CYCLOBUTANE-1-CARBOXYLIC ACID, 98%, 98%, 1-(4-METHYLPHENYL)CYCLOBUTANE-1-CARBOXYLIC ACID, 97%, 1-(p-Tolyl)cyclobutanecarboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 50mg, 500mg, 2.5g.
1-(4-methylphenyl)cyclobutane-1-carboxylic acid (CAS 50921-38-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 1-(4-methylphenyl)cyclobutane-1-carboxylic acid. InChIKey: GFNPCJCIUWSWIV-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-(4-methylphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | GFNPCJCIUWSWIV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)