1-(4-Methoxyphenyl)piperidin-4-amine, 95%
cas: 259663-88-2 — see every product listed under this CAS number, including other names
1-(4-Methoxyphenyl)piperidin-4-amine, 95% (CAS 259663-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A700038-250mg |
| cas | 259663-88-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1399.44 Pln | |
| Ambeed | 1g | 3641.12 Pln | |
| BLDpharm | 100mg | 841.95 Pln | |
| BLDpharm | 250mg | 1369.54 Pln | |
| BLDpharm | 1g | 3574.32 Pln | |
| Chemat | 100mg | 909.20 Pln | |
| Chemat | 250mg | 1504.40 Pln | |
| Chemat | 1g | 4024.40 Pln | |
| Fluorochem | 1g | 7328.69 Pln | |
| Fluorochem | 100mg | 1674.43 Pln | |
| Fluorochem | 250mg | 2799.03 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-methoxyphenyl)piperidin-4-amine (CAS 259663-88-2) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 1-(4-methoxyphenyl)piperidin-4-amine. InChIKey: LLQPZJOXQGVEEQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)piperidin-4-amine |
| InChIKey | LLQPZJOXQGVEEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2CCC(CC2)N |
Computed by PubChem (NCBI)