CAS 926231-65-4 appears in our catalog under these names: N-(5-Amino-2-methylphenyl)-2,2-dimethylpropanamide, 95%, N-(5-Amino-2-methylphenyl)pivalamide, 97%, N-(5-Amino-2-methylphenyl)-2,2-dimethylpropanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-(5-amino-2-methylphenyl)-2,2-dimethylpropanamide (CAS 926231-65-4) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: N-(5-amino-2-methylphenyl)-2,2-dimethylpropanamide. InChIKey: LFTBLXHKJRTFKB-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | N-(5-amino-2-methylphenyl)-2,2-dimethylpropanamide |
| InChIKey | LFTBLXHKJRTFKB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)