CAS 1188506-56-0 is the registry number for 4-Amino-n,n-diethyl-2-methyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-amino-N,N-diethyl-2-methylbenzamide (CAS 1188506-56-0) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 4-amino-N,N-diethyl-2-methylbenzamide. InChIKey: JGTMFNIOLBWLPM-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-amino-N,N-diethyl-2-methylbenzamide |
| InChIKey | JGTMFNIOLBWLPM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)N)C |
Computed by PubChem (NCBI)