cas: 38560-30-4 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)piperidin-2-one, 98% (CAS 38560-30-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238290-1G |
| cas | 38560-30-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 581.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-nitrophenyl)piperidin-2-one (CAS 38560-30-4) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(4-nitrophenyl)piperidin-2-one. InChIKey: VPCQXIGQMFWXII-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperidin-2-one |
| InChIKey | VPCQXIGQMFWXII-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)