cas: 30459-17-7 — see every product listed under this CAS number, including other names
1-(4-Trifluoromethylphenyl)piperazine, 98%, 98% (CAS 30459-17-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11417V-1g |
| cas | 30459-17-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 237.20 Pln | |
| Chemat | 25g | 395.60 Pln | |
| Chemat | 50g | 707.60 Pln | |
| Chemat | 100g | 1307.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[4-(trifluoromethyl)phenyl]piperazine (CAS 30459-17-7) is a chemical compound with the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]piperazine. InChIKey: IBQMAPSJLHRQPE-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]piperazine |
| InChIKey | IBQMAPSJLHRQPE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)