Products 1076205-99-6
CAS 1076205-99-6 appears in our catalog under these names: 1-[(2,3,5-Trifluorophenyl)methyl]piperazine, 95%, 1-((2,3,5-Trifluorophenyl)methyl)piperazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg.
1-[(2,3,5-trifluorophenyl)methyl]piperazine (CAS 1076205-99-6) is a chemical compound with the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. IUPAC name: 1-[(2,3,5-trifluorophenyl)methyl]piperazine. InChIKey: ZBFVHSXKFKZFOD-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 1-[(2,3,5-trifluorophenyl)methyl]piperazine |
| InChIKey | ZBFVHSXKFKZFOD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C(=CC(=C2)F)F)F |
Computed by PubChem (NCBI)