CAS 133184-80-2 appears in our catalog under these names: N-(2-Amino-4-trifluoromethylphenyl)pyrrolidine, N-(2-Amino-4-trifluoromethylphenyl)pyrrolidine, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 2.5g, 5g.
2-pyrrolidin-1-yl-5-(trifluoromethyl)aniline (CAS 133184-80-2) is a chemical compound with the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. IUPAC name: 2-pyrrolidin-1-yl-5-(trifluoromethyl)aniline. InChIKey: HPDFKXPVMXSXGE-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 2-pyrrolidin-1-yl-5-(trifluoromethyl)aniline |
| InChIKey | HPDFKXPVMXSXGE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)