cas: 346656-39-1 — see every product listed under this CAS number, including other names
1-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorobenzene, 98%, 98% (CAS 346656-39-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ERP-100mg |
| cas | 346656-39-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 25g | 2075.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 346656-39-1) is a chemical compound with the molecular formula C11H14BFO2 and a molecular weight of 208.04 g/mol. IUPAC name: 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: ZNFBLQHZFSLYQB-UHFFFAOYSA-N.
| Molecular formula | C11H14BFO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | ZNFBLQHZFSLYQB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2F |
Computed by PubChem (NCBI)