CAS 2225178-77-6 appears in our catalog under these names: (4-Cyclopentyl-3-fluorophenyl)boronic acid, 95%, 2–Fluoro–4–(cyclopentyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg, 25mg, 5mg.
(4-cyclopentyl-2-fluorophenyl)boronic acid (CAS 2225178-77-6) is a chemical compound with the molecular formula C11H14BFO2 and a molecular weight of 208.04 g/mol. IUPAC name: (4-cyclopentyl-2-fluorophenyl)boronic acid. InChIKey: PABXKRMZVZLYSP-UHFFFAOYSA-N.
| Molecular formula | C11H14BFO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | (4-cyclopentyl-2-fluorophenyl)boronic acid |
| InChIKey | PABXKRMZVZLYSP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2CCCC2)F)(O)O |
Computed by PubChem (NCBI)