cas: 346656-39-1 — see every product listed under this CAS number, including other names
2-(2-Fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane 98% (CAS 346656-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A588881-250mg |
| cas | 346656-39-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 843.19 Pln | |
| Ambeed | 25g | 2695.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A588881 |
2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 346656-39-1) is a chemical compound with the molecular formula C11H14BFO2 and a molecular weight of 208.04 g/mol. IUPAC name: 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: ZNFBLQHZFSLYQB-UHFFFAOYSA-N.
| Molecular formula | C11H14BFO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | ZNFBLQHZFSLYQB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2F |
Computed by PubChem (NCBI)