cas: 1384807-90-2 — see every product listed under this CAS number, including other names
1-(5-(Trifluoromethyl)benzo[d]thiazol-2-yl)azetidin-3-ol, 95% (CAS 1384807-90-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982976-100MG |
| cas | 1384807-90-2 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1273.53 Pln | |
| Fluorochem | 1g | 2465.82 Pln | |
| Fluorochem | 5g | 7078.78 Pln | |
| Fluorochem | 10g | 11233.56 Pln | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 1312.40 Pln | |
| Chemat | 5g | 4437.20 Pln | |
| Chemat | 10g | 6314.00 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]azetidin-3-ol (CAS 1384807-90-2) is a chemical compound with the molecular formula C11H9F3N2OS and a molecular weight of 274.26 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]azetidin-3-ol. InChIKey: DFWFCEPSFKQHRY-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2OS |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]azetidin-3-ol |
| InChIKey | DFWFCEPSFKQHRY-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC3=C(S2)C=CC(=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)