CAS 2088914-59-2 is the registry number for Enzalutamide Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
O-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate (CAS 2088914-59-2) is a chemical compound with the molecular formula C11H9F3N2OS and a molecular weight of 274.26 g/mol. IUPAC name: O-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate. InChIKey: CCRMQPKCXCVQDE-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2OS |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | O-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate |
| InChIKey | CCRMQPKCXCVQDE-UHFFFAOYSA-N |
| SMILES | CCOC(=S)NC1=CC(=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)