Products 2088914-59-2

CAS 2088914-59-2 is the registry number for Enzalutamide Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

O-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate (CAS 2088914-59-2) is a chemical compound with the molecular formula C11H9F3N2OS and a molecular weight of 274.26 g/mol. IUPAC name: O-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate. InChIKey: CCRMQPKCXCVQDE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F3N2OS
Molecular weight274.26 g/mol
IUPAC nameO-ethyl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate
InChIKeyCCRMQPKCXCVQDE-UHFFFAOYSA-N
SMILESCCOC(=S)NC1=CC(=C(C=C1)C#N)C(F)(F)F

Computed by PubChem (NCBI)