CAS 937628-92-7 is the registry number for 5-{(4-(trifluoromethoxy)phenyl)methyl}-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-amine (CAS 937628-92-7) is a chemical compound with the molecular formula C11H9F3N2OS and a molecular weight of 274.26 g/mol. IUPAC name: 5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-amine. InChIKey: SRWPNXNORWHNNM-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2OS |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | 5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-amine |
| InChIKey | SRWPNXNORWHNNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)OC(F)(F)F |
Computed by PubChem (NCBI)