cas: 207557-34-4 — see every product listed under this CAS number, including other names
1-(5-(Trifluoromethyl)pyridin-2-yl)ethane-1,2-diamine, 98+% (CAS 207557-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A423956-100mg |
| cas | 207557-34-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 2101.12 Pln | |
| AmBeed | 10g | 31467.73 Pln | |
| AmBeed | 5g | 21227.50 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (CAS 207557-34-4) is a chemical compound with the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. IUPAC name: N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine. InChIKey: PFGNVKSFFSSFEU-UHFFFAOYSA-N.
| Molecular formula | C8H10F3N3 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | N'-[5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| InChIKey | PFGNVKSFFSSFEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)NCCN |
Computed by PubChem (NCBI)