Products 874880-82-7
CAS 874880-82-7 appears in our catalog under these names: 5-(Trifluoromethyl)-n2,n2-dimethylpyridine-2,3-diamine, 95%, N2,N2-Dimethyl-5-(trifluoromethyl)pyridine-2,3-diamine, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-N,2-N-dimethyl-5-(trifluoromethyl)pyridine-2,3-diamine (CAS 874880-82-7) is a chemical compound with the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. IUPAC name: 2-N,2-N-dimethyl-5-(trifluoromethyl)pyridine-2,3-diamine. InChIKey: RISXUTSJITYHAG-UHFFFAOYSA-N.
| Molecular formula | C8H10F3N3 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-5-(trifluoromethyl)pyridine-2,3-diamine |
| InChIKey | RISXUTSJITYHAG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)C(F)(F)F)N |
Computed by PubChem (NCBI)