CAS 1227955-19-2 is the registry number for N-(2-Aminoethyl)-n-[6-(trifluoromethyl)pyridin-2-yl]amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N'-[6-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (CAS 1227955-19-2) is a chemical compound with the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. IUPAC name: N'-[6-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine. InChIKey: DGEWMZAPGVLJIO-UHFFFAOYSA-N.
| Molecular formula | C8H10F3N3 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | N'-[6-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| InChIKey | DGEWMZAPGVLJIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)NCCN)C(F)(F)F |
Computed by PubChem (NCBI)