cas: 1169882-53-4 — see every product listed under this CAS number, including other names
1-(5-Bromo-2-methoxyphenyl)-2,2,2-trifluoroethan-1-ol 95% (CAS 1169882-53-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1706522-100mg |
| cas | 1169882-53-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1082.38 Pln | |
| Ambeed | 5g | 3134.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1706522 |
1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol (CAS 1169882-53-4) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: 1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: OENIVZWOODZCSP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | 1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | OENIVZWOODZCSP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)