cas: 1169882-53-4 — see every product listed under this CAS number, including other names
5-BROMO-2-METHOXY-ALPHA-(TRIFLUOROMETHYL)BENZYL ALCOHOL, 98% (CAS 1169882-53-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F822260-100MG |
| cas | 1169882-53-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1346.42 Pln | |
| Fluorochem | 5g | 3923.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol (CAS 1169882-53-4) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: 1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: OENIVZWOODZCSP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | 1-(5-bromo-2-methoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | OENIVZWOODZCSP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)