Products 1355247-61-8
CAS 1355247-61-8 is the registry number for 4-Bromo-2-ethoxy-1-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-ethoxy-1-(trifluoromethoxy)benzene (CAS 1355247-61-8) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: 4-bromo-2-ethoxy-1-(trifluoromethoxy)benzene. InChIKey: DDSFFIPBKXXXCY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | 4-bromo-2-ethoxy-1-(trifluoromethoxy)benzene |
| InChIKey | DDSFFIPBKXXXCY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)