cas: 412347-30-9 — see every product listed under this CAS number, including other names
1-(5-Bromo-3-pyridyl)piperazine 96% (CAS 412347-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310287-100mg |
| cas | 412347-30-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 2139.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A310287 |
1-(5-bromo-3-pyridinyl)piperazine (CAS 412347-30-9) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(5-bromo-3-pyridinyl)piperazine. InChIKey: ACYRDEABHZRABW-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(5-bromo-3-pyridinyl)piperazine |
| InChIKey | ACYRDEABHZRABW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)