CAS 87394-56-7 appears in our catalog under these names: 3-Bromo-2-piperazinopyridine, 96%, 1–(3–Bromopyridin–2–yl)piperazine, 3-Bromo-2-piperazinopyridine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 25g, 5g, 1g.
1-(3-bromo-2-pyridinyl)piperazine (CAS 87394-56-7) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(3-bromo-2-pyridinyl)piperazine. InChIKey: KYMBSIUPQJYAFF-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(3-bromo-2-pyridinyl)piperazine |
| InChIKey | KYMBSIUPQJYAFF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)