CAS 1539561-77-7 is the registry number for 1-(2-Bromo-4,6-dimethylphenyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-4,6-dimethylphenyl)guanidine (CAS 1539561-77-7) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 2-(2-bromo-4,6-dimethylphenyl)guanidine. InChIKey: NHEAGBFICRXDQM-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-(2-bromo-4,6-dimethylphenyl)guanidine |
| InChIKey | NHEAGBFICRXDQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)N=C(N)N)C |
Computed by PubChem (NCBI)