cas: 149806-52-0 — see every product listed under this CAS number, including other names
1-(5-Bromopyridin-2-yl)piperidin-4-ol, 98%, 98% (CAS 149806-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M2A-250mg |
| cas | 149806-52-0 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 2080.40 Pln | |
| Chemat | 100mg | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(5-bromo-2-pyridinyl)piperidin-4-ol (CAS 149806-52-0) is a chemical compound with the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidin-4-ol. InChIKey: LSGWHPYPLCIXCK-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidin-4-ol |
| InChIKey | LSGWHPYPLCIXCK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)