CAS 104290-44-0 appears in our catalog under these names: 5-Bromo-n,n-diethyl-3-pyridinecarboxamide, 97%, 5-Bromo-N,N-diethylnicotinamide, 95+%, 5-Bromo-N,N-diethyl-3-pyridinecarboxamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
5-bromo-N,N-diethylpyridine-3-carboxamide (CAS 104290-44-0) is a chemical compound with the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. IUPAC name: 5-bromo-N,N-diethylpyridine-3-carboxamide. InChIKey: INALCDDCRXNOBA-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 5-bromo-N,N-diethylpyridine-3-carboxamide |
| InChIKey | INALCDDCRXNOBA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)