CAS 873302-39-7 is the registry number for N-(5-Bromo-pyridin-3-yl)-2,2-dimethyl-propionamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(5-bromo-3-pyridinyl)-2,2-dimethylpropanamide (CAS 873302-39-7) is a chemical compound with the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. IUPAC name: N-(5-bromo-3-pyridinyl)-2,2-dimethylpropanamide. InChIKey: OKUYTVHRBWHVQU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | N-(5-bromo-3-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | OKUYTVHRBWHVQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)