cas: 886364-44-9 — see every product listed under this CAS number, including other names
1-(5-Bromopyridin-3-yl)-2,2,2-trifluoroethanone, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 886364-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119AJ3-100mg |
| cas | 886364-44-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 851.60 Pln | |
| Chemat | 250mg | 1715.60 Pln | |
| Chemat | 1g | 5027.60 Pln | |
| Chemat | 5g | 15707.60 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone (CAS 886364-44-9) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: DALOWJQZHSEOII-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | DALOWJQZHSEOII-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)