Products 1227601-42-4
CAS 1227601-42-4 is the registry number for 3-Bromo-5-(trifluoromethyl)picolinaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-5-(trifluoromethyl)pyridine-2-carbaldehyde (CAS 1227601-42-4) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)pyridine-2-carbaldehyde. InChIKey: YQJSHHUAEQVWJY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)pyridine-2-carbaldehyde |
| InChIKey | YQJSHHUAEQVWJY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C=O)C(F)(F)F |
Computed by PubChem (NCBI)