CAS 886364-50-7 appears in our catalog under these names: 1-(5-Bromopyridin-2-yl)-2,2,2-trifluoroethanone, 95%, 1-(5-Bromopyridin-2-yl)-2,2,2-trifluoroethanone, 98%, 1-(5-Bromopyridin-2-yl)-2,2,2-trifluoroethanone, 98%(GC-MS),RG, 98%(GC-MS),RG, 1-(5-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-one, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanone (CAS 886364-50-7) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: RQVDHNFXLLBQGC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | RQVDHNFXLLBQGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)