cas: 6123-63-3 — see every product listed under this CAS number, including other names
1-(5-Methyl-1-phenyl-1H-pyrazol-4-yl)ethanone, 98+%, 98+% (CAS 6123-63-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KMN-500mg |
| cas | 6123-63-3 |
| size | 500mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 261.20 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 899.60 Pln | |
| Chemat | 10g | 1667.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
1-(5-methyl-1-phenylpyrazol-4-yl)ethanone (CAS 6123-63-3) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-(5-methyl-1-phenylpyrazol-4-yl)ethanone. InChIKey: FZEDJUVQMGBVRC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-(5-methyl-1-phenylpyrazol-4-yl)ethanone |
| InChIKey | FZEDJUVQMGBVRC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=CC=C2)C(=O)C |
Computed by PubChem (NCBI)